cas: 1218790-05-6 — see every product listed under this CAS number, including other names
2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine, 98% (CAS 1218790-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232270-250MG |
| cas | 1218790-05-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1195.43 Pln | |
| Fluorochem | 25g | 5152.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine (CAS 1218790-05-6) is a chemical compound with the molecular formula C12H14BClF3NO2 and a molecular weight of 307.50 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine. InChIKey: AQRLOVKDJVLZSA-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF3NO2 |
|---|---|
| Molecular weight | 307.50 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine |
| InChIKey | AQRLOVKDJVLZSA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)