cas: 147992-80-1 — see every product listed under this CAS number, including other names
2-Chloro-4-(dimethylamino)nicotinonitrile 95% (CAS 147992-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A666437-100mg |
| cas | 147992-80-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1338.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A666437 |
2-chloro-4-(dimethylamino)pyridine-3-carbonitrile (CAS 147992-80-1) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 2-chloro-4-(dimethylamino)pyridine-3-carbonitrile. InChIKey: CAMVNWAYWUPMTI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-chloro-4-(dimethylamino)pyridine-3-carbonitrile |
| InChIKey | CAMVNWAYWUPMTI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=NC=C1)Cl)C#N |
Computed by PubChem (NCBI)