CAS 147992-80-1 appears in our catalog under these names: 2-Chloro-4-(dimethylamino)nicotinonitrile, 95%, 2–Chloro–4–(dimethylamino)nicotinonitrile, 2-Chloro-4-(dimethylamino)nicotinonitrile 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-4-(dimethylamino)pyridine-3-carbonitrile (CAS 147992-80-1) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 2-chloro-4-(dimethylamino)pyridine-3-carbonitrile. InChIKey: CAMVNWAYWUPMTI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-chloro-4-(dimethylamino)pyridine-3-carbonitrile |
| InChIKey | CAMVNWAYWUPMTI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=NC=C1)Cl)C#N |
Computed by PubChem (NCBI)