CAS 117837-77-1 appears in our catalog under these names: 4-Cyanobenzamidine hydrochloride, 95%, 4-Cyanobenzamidine Hydrochloride, 97%, 4–Cyanobenzamidine Hydrochloride, 4-Cyanobenzamidine Hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
4-cyanobenzenecarboximidamide;hydrochloride (CAS 117837-77-1) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 4-cyanobenzenecarboximidamide;hydrochloride. InChIKey: IKVRHGPKSBUMIO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-cyanobenzenecarboximidamide;hydrochloride |
| InChIKey | IKVRHGPKSBUMIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(=N)N.Cl |
Computed by PubChem (NCBI)