cas: 945391-06-0 — see every product listed under this CAS number, including other names
2-Chloro-4-cyanophenylboronic Acid Pinacol Ester, 98%, 98% (CAS 945391-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIBM-100mg |
| cas | 945391-06-0 |
| size | 100mg |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 837.20 Pln | |
| Chemat | 25g | 2742.80 Pln | |
| Chemat | 100g | 6952.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 945391-06-0) is a chemical compound with the molecular formula C13H15BClNO2 and a molecular weight of 263.53 g/mol. IUPAC name: 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: AGVDMZNQFRCYMD-UHFFFAOYSA-N.
| Molecular formula | C13H15BClNO2 |
|---|---|
| Molecular weight | 263.53 g/mol |
| IUPAC name | 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | AGVDMZNQFRCYMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)