cas: 945391-06-0 — see every product listed under this CAS number, including other names
3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97% (CAS 945391-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517810-100MG |
| cas | 945391-06-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1252.70 Pln | |
| Fluorochem | 25g | 3902.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 945391-06-0) is a chemical compound with the molecular formula C13H15BClNO2 and a molecular weight of 263.53 g/mol. IUPAC name: 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: AGVDMZNQFRCYMD-UHFFFAOYSA-N.
| Molecular formula | C13H15BClNO2 |
|---|---|
| Molecular weight | 263.53 g/mol |
| IUPAC name | 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | AGVDMZNQFRCYMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)