cas: 179056-94-1 — see every product listed under this CAS number, including other names
2-Chloro-4-methoxy-6-methyl-3-nitropyridine, 95% (CAS 179056-94-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F322342-250MG |
| cas | 179056-94-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1351.63 Pln | |
| Fluorochem | 10g | 1861.86 Pln | |
| Fluorochem | 25g | 3580.01 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-4-methoxy-6-methyl-3-nitropyridine (CAS 179056-94-1) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 2-chloro-4-methoxy-6-methyl-3-nitropyridine. InChIKey: HZNSXSSJRAACCF-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 2-chloro-4-methoxy-6-methyl-3-nitropyridine |
| InChIKey | HZNSXSSJRAACCF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)Cl)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)