CAS 6259-08-1 appears in our catalog under these names: 5-Chloro-2-methoxy-4-nitroaniline, 95%, 5–Chloro–2–Methoxy–4–Nitroaniline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
5-chloro-2-methoxy-4-nitroaniline (CAS 6259-08-1) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 5-chloro-2-methoxy-4-nitroaniline. InChIKey: POKAEVPBUOLQIY-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 5-chloro-2-methoxy-4-nitroaniline |
| InChIKey | POKAEVPBUOLQIY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)