CAS 35824-85-2 appears in our catalog under these names: 6-Chloro-5-formyl-1,3-dimethyluracil, 95%, 6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde, 95+%, 6-Chloro-5-formyl-1,3-dimethyluracil. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 0,5g.
4-chloro-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde (CAS 35824-85-2) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 4-chloro-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde. InChIKey: QETLJJSSAJXEIO-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 4-chloro-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde |
| InChIKey | QETLJJSSAJXEIO-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)C=O)Cl |
Computed by PubChem (NCBI)