cas: 1208081-91-7 — see every product listed under this CAS number, including other names
2-Chloro-4-methyl-pyridine-3-sulphonyl chloride 97% (CAS 1208081-91-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218272-100mg |
| cas | 1208081-91-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1037.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A218272 |
2-chloro-4-methylpyridine-3-sulfonyl chloride (CAS 1208081-91-7) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 2-chloro-4-methylpyridine-3-sulfonyl chloride. InChIKey: OXCJAYGONSGGQJ-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 2-chloro-4-methylpyridine-3-sulfonyl chloride |
| InChIKey | OXCJAYGONSGGQJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)