Products 889944-76-7
CAS 889944-76-7 appears in our catalog under these names: 6-Chloro-4-methylpyridine-3-sulfonyl chloride, 97%, 6-Chloro-4-methylpyridine-3-sulfonyl chloride, 6-Chloro-4-methylpyridine-3-sulfonyl chloride 97%, 6-Chloro-4-methyl-3-pyridinesulfonyl chloride, 97%, 97%, 6-Chloro-4-methylpyridine-3-sulfonyl chloride, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g, 100mg, 10g.
6-chloro-4-methylpyridine-3-sulfonyl chloride (CAS 889944-76-7) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 6-chloro-4-methylpyridine-3-sulfonyl chloride. InChIKey: BYILBFFYTJJANW-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 6-chloro-4-methylpyridine-3-sulfonyl chloride |
| InChIKey | BYILBFFYTJJANW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)