CAS 37105-10-5 appears in our catalog under these names: 6–Chloro–5–methylpyridine–3–sulfonyl chloride, 6-Chloro-5-methylpyridine-3-sulfonyl chloride, 95%, 6-Chloro-5-methylpyridine-3-sulfonyl chloride 95+%, 6-Chloro-5-methyl-pyridine-3-sulfonyl chloride, 95+%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
6-chloro-5-methylpyridine-3-sulfonyl chloride (CAS 37105-10-5) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 6-chloro-5-methylpyridine-3-sulfonyl chloride. InChIKey: SMRVMBZCJFWJFF-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 6-chloro-5-methylpyridine-3-sulfonyl chloride |
| InChIKey | SMRVMBZCJFWJFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)