cas: 292138-59-1 — see every product listed under this CAS number, including other names
2-Chloro-4-methylthiazole-5-sulfonyl chloride 98% (CAS 292138-59-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A740040-100mg |
| cas | 292138-59-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2350.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A740040 |
2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride (CAS 292138-59-1) is a chemical compound with the molecular formula C4H3Cl2NO2S2 and a molecular weight of 232.1 g/mol. IUPAC name: 2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: IBMLFZUEKAQELM-UHFFFAOYSA-N.
| Molecular formula | C4H3Cl2NO2S2 |
|---|---|
| Molecular weight | 232.1 g/mol |
| IUPAC name | 2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | IBMLFZUEKAQELM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)