cas: 292138-59-1 — see every product listed under this CAS number, including other names
2-Chloro-4-methylthiazole-5-sulfonyl chloride, 98%, 98% (CAS 292138-59-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113XPZ-100mg |
| cas | 292138-59-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 760.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride (CAS 292138-59-1) is a chemical compound with the molecular formula C4H3Cl2NO2S2 and a molecular weight of 232.1 g/mol. IUPAC name: 2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: IBMLFZUEKAQELM-UHFFFAOYSA-N.
| Molecular formula | C4H3Cl2NO2S2 |
|---|---|
| Molecular weight | 232.1 g/mol |
| IUPAC name | 2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | IBMLFZUEKAQELM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)