cas: 1073354-96-7 — see every product listed under this CAS number, including other names
2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine 98% (CAS 1073354-96-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210192-250mg |
| cas | 1073354-96-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1521.81 Pln | |
| Ambeed | 25g | 7317.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210192 |
2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 1073354-96-7) is a chemical compound with the molecular formula C11H16BClN2O2 and a molecular weight of 254.52 g/mol. IUPAC name: 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: OTPWQANCPKJXBK-UHFFFAOYSA-N.
| Molecular formula | C11H16BClN2O2 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | OTPWQANCPKJXBK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Cl)N |
Computed by PubChem (NCBI)