CAS 2225174-16-1 appears in our catalog under these names: 2-Chloro-4-(n-methylpiperazin-1-yl)phenylboronic acid, 96%, 2–Chloro–4–(N–methylpiperazin–1–yl)phenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 10mg, 25mg.
[2-chloro-4-(4-methylpiperazin-1-yl)phenyl]boronic acid (CAS 2225174-16-1) is a chemical compound with the molecular formula C11H16BClN2O2 and a molecular weight of 254.52 g/mol. IUPAC name: [2-chloro-4-(4-methylpiperazin-1-yl)phenyl]boronic acid. InChIKey: GGGSWFYTTUHKNF-UHFFFAOYSA-N.
| Molecular formula | C11H16BClN2O2 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | [2-chloro-4-(4-methylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | GGGSWFYTTUHKNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCN(CC2)C)Cl)(O)O |
Computed by PubChem (NCBI)