CAS 1150561-74-2 appears in our catalog under these names: 2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine, 95+%, 3-Amino-2-chloropyridine-6-boronic acid, pinacol ester, 97%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 1150561-74-2) is a chemical compound with the molecular formula C11H16BClN2O2 and a molecular weight of 254.52 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: RFWDIEIRRPLYLP-UHFFFAOYSA-N.
| Molecular formula | C11H16BClN2O2 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | RFWDIEIRRPLYLP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=C(C=C2)N)Cl |
Computed by PubChem (NCBI)