cas: 2096332-48-6 — see every product listed under this CAS number, including other names
2-Chloro-5-(morpholinomethyl)phenylboronic acid, pinacol ester, 97% (CAS 2096332-48-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A685668-10g |
| cas | 2096332-48-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 7178.92 Pln | |
| AmBeed | 1g | 1424.08 Pln | |
| AmBeed | 5g | 4132.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (CAS 2096332-48-6) is a chemical compound with the molecular formula C17H25BClNO3 and a molecular weight of 337.6 g/mol. IUPAC name: 4-[[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine. InChIKey: GCHRRPPVKXGTAW-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO3 |
|---|---|
| Molecular weight | 337.6 g/mol |
| IUPAC name | 4-[[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| InChIKey | GCHRRPPVKXGTAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CN3CCOCC3)Cl |
Computed by PubChem (NCBI)