Products 2096332-48-6
CAS 2096332-48-6 appears in our catalog under these names: 2-Chloro-5-(morpholinomethyl)phenylboronic acid, pinacol ester, 95%, 2-Chloro-5-(morpholinomethyl)phenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-[[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (CAS 2096332-48-6) is a chemical compound with the molecular formula C17H25BClNO3 and a molecular weight of 337.6 g/mol. IUPAC name: 4-[[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine. InChIKey: GCHRRPPVKXGTAW-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO3 |
|---|---|
| Molecular weight | 337.6 g/mol |
| IUPAC name | 4-[[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| InChIKey | GCHRRPPVKXGTAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CN3CCOCC3)Cl |
Computed by PubChem (NCBI)