Products 2096329-91-6
CAS 2096329-91-6 is the registry number for 4-Chloro-2-(morpholinomethyl)phenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-[[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (CAS 2096329-91-6) is a chemical compound with the molecular formula C17H25BClNO3 and a molecular weight of 337.6 g/mol. IUPAC name: 4-[[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine. InChIKey: YXRJYRZYBHPDLB-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO3 |
|---|---|
| Molecular weight | 337.6 g/mol |
| IUPAC name | 4-[[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| InChIKey | YXRJYRZYBHPDLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)CN3CCOCC3 |
Computed by PubChem (NCBI)