2-Chloro-5-(trifluoromethyl)pyrazine, 95%
cas: 799557-87-2 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)pyrazine, 95% (CAS 799557-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A595557-100mg |
| cas | 799557-87-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 737.50 Pln | |
| Ambeed | 10g | 1388.31 Pln | |
| Ambeed | 25g | 3346.31 Pln | |
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 786.41 Pln | |
| BLDpharm | 10g | 1491.72 Pln | |
| BLDpharm | 25g | 3602.09 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-(trifluoromethyl)pyrazine (CAS 799557-87-2) is a chemical compound with the molecular formula C5H2ClF3N2 and a molecular weight of 182.53 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)pyrazine. InChIKey: AIEGIFIEQXZBCP-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF3N2 |
|---|---|
| Molecular weight | 182.53 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)pyrazine |
| InChIKey | AIEGIFIEQXZBCP-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)