CAS 845618-08-8 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)pyrimidine 95%, 5-Chloro-2-(trifluoromethyl)pyrimidine, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-chloro-2-(trifluoromethyl)pyrimidine (CAS 845618-08-8) is a chemical compound with the molecular formula C5H2ClF3N2 and a molecular weight of 182.53 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)pyrimidine. InChIKey: MXCKWZRZRRBNMX-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF3N2 |
|---|---|
| Molecular weight | 182.53 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)pyrimidine |
| InChIKey | MXCKWZRZRRBNMX-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)