CAS 281652-58-2 is the registry number for 2-Chloro-5-iodobenzoyl chloride, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-5-iodobenzoyl chloride (CAS 281652-58-2) is a chemical compound with the molecular formula C7H3Cl2IO and a molecular weight of 300.90 g/mol. IUPAC name: 2-chloro-5-iodobenzoyl chloride. InChIKey: CRBYUOHFEZMJTE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO |
|---|---|
| Molecular weight | 300.90 g/mol |
| IUPAC name | 2-chloro-5-iodobenzoyl chloride |
| InChIKey | CRBYUOHFEZMJTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(=O)Cl)Cl |
Computed by PubChem (NCBI)