Products 281652-58-2

CAS 281652-58-2 is the registry number for 2-Chloro-5-iodobenzoyl chloride, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-chloro-5-iodobenzoyl chloride (CAS 281652-58-2) is a chemical compound with the molecular formula C7H3Cl2IO and a molecular weight of 300.90 g/mol. IUPAC name: 2-chloro-5-iodobenzoyl chloride. InChIKey: CRBYUOHFEZMJTE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2IO
Molecular weight300.90 g/mol
IUPAC name2-chloro-5-iodobenzoyl chloride
InChIKeyCRBYUOHFEZMJTE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1I)C(=O)Cl)Cl

Computed by PubChem (NCBI)