CAS 177167-53-2 appears in our catalog under these names: 2,6-Dichloro-4-iodobenzaldehyde, 97%, 2,6-Dichloro-4-iodobenzaldehyde 95%, 2,6-Dichloro-4-Iodobenzaldehyde, 95%, 95%, 2,6-Dichloro-4-iodobenzaldehyde, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 100mg, 250mg.
2,6-dichloro-4-iodobenzaldehyde (CAS 177167-53-2) is a chemical compound with the molecular formula C7H3Cl2IO and a molecular weight of 300.90 g/mol. IUPAC name: 2,6-dichloro-4-iodobenzaldehyde. InChIKey: MXFZNBCNKBQFAR-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO |
|---|---|
| Molecular weight | 300.90 g/mol |
| IUPAC name | 2,6-dichloro-4-iodobenzaldehyde |
| InChIKey | MXFZNBCNKBQFAR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C=O)Cl)I |
Computed by PubChem (NCBI)