CAS 1225032-69-8 appears in our catalog under these names: 3,5-Dichloro-4-iodobenzaldehyde, 98%, 3,5-Dichloro-4-iodobenzaldehyde, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 25g, 1g.
3,5-dichloro-4-iodobenzaldehyde (CAS 1225032-69-8) is a chemical compound with the molecular formula C7H3Cl2IO and a molecular weight of 300.90 g/mol. IUPAC name: 3,5-dichloro-4-iodobenzaldehyde. InChIKey: AOKZFBTVLMJVQS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO |
|---|---|
| Molecular weight | 300.90 g/mol |
| IUPAC name | 3,5-dichloro-4-iodobenzaldehyde |
| InChIKey | AOKZFBTVLMJVQS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)I)Cl)C=O |
Computed by PubChem (NCBI)