2-Chloro-5-Iodobenzoyl chloride, 95%
cas: 281652-58-2 — see every product listed under this CAS number, including other names
2-Chloro-5-Iodobenzoyl chloride, 95% (CAS 281652-58-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A454147-250mg |
| cas | 281652-58-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 5g | 3602.19 Pln | |
| BLDpharm | 100mg | 192.18 Pln | |
| BLDpharm | 250mg | 258.82 Pln | |
| BLDpharm | 1g | 819.74 Pln | |
| BLDpharm | 5g | 3535.45 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 1000.40 Pln | |
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 518.59 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-iodobenzoyl chloride (CAS 281652-58-2) is a chemical compound with the molecular formula C7H3Cl2IO and a molecular weight of 300.90 g/mol. IUPAC name: 2-chloro-5-iodobenzoyl chloride. InChIKey: CRBYUOHFEZMJTE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO |
|---|---|
| Molecular weight | 300.90 g/mol |
| IUPAC name | 2-chloro-5-iodobenzoyl chloride |
| InChIKey | CRBYUOHFEZMJTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(=O)Cl)Cl |
Computed by PubChem (NCBI)