CAS 444666-39-1 appears in our catalog under these names: 2–Chloro–5–fluorophenylboronic Acid (contains varying amounts of Anhydride, 2-Chloro-5-fluorobenzeneboronic acid, 98%, 98%, 2-Chloro-5-fluorobenzeneboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g.
(2-chloro-5-fluorophenyl)boronic acid (CAS 444666-39-1) is a chemical compound with the molecular formula C6H5BClFO2 and a molecular weight of 174.37 g/mol. IUPAC name: (2-chloro-5-fluorophenyl)boronic acid. InChIKey: OVTZJDSREVDCTJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BClFO2 |
|---|---|
| Molecular weight | 174.37 g/mol |
| IUPAC name | (2-chloro-5-fluorophenyl)boronic acid |
| InChIKey | OVTZJDSREVDCTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)Cl)(O)O |
Computed by PubChem (NCBI)