2-Chloro-5-fluorobenzeneboronic acid, 98%
cas: 444666-39-1 — see every product listed under this CAS number, including other names
2-Chloro-5-fluorobenzeneboronic acid, 98% (CAS 444666-39-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 250mg, 1g, 50g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F024879-5G |
| cas | 444666-39-1 |
| size | 5g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 575.86 Pln | |
| Fluorochem | 100g | 1976.41 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 559.50 Pln | |
| Ambeed | 100g | 1922.31 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 50g | 626.00 Pln | |
| Chemat | 100g | 1163.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2-chloro-5-fluorophenyl)boronic acid (CAS 444666-39-1) is a chemical compound with the molecular formula C6H5BClFO2 and a molecular weight of 174.37 g/mol. IUPAC name: (2-chloro-5-fluorophenyl)boronic acid. InChIKey: OVTZJDSREVDCTJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BClFO2 |
|---|---|
| Molecular weight | 174.37 g/mol |
| IUPAC name | (2-chloro-5-fluorophenyl)boronic acid |
| InChIKey | OVTZJDSREVDCTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-5-fluorobenzeneboronic acid, 2-chloro-5-fluorophenylboronic acid, (2-chloro-5-fluorophenyl)boronic acid, (2-chloro-5-fluoro-phenyl)boronic acid, Boronic acid, (2-chloro-5-fluorophenyl)-, 2-Chloro-5-fluorobenzeneboronicacid, 2-Chloro-5-fluorophenylboronic acid (contains varying amounts of Anhydride), 2-Chloro-5-fluorobenzeneboronic acid;2-Chloro-5-fluorophenylboronic acid, 2-Chloro-5-Fluorophenyl-Boronic Acid, 2chloro-5-fluorophenylboronic acid