cas: 6294-93-5 — see every product listed under this CAS number, including other names
2-Chloro-5-hydroxybenzotrifluoride 97% (CAS 6294-93-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A589092-5g |
| cas | 6294-93-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 609.56 Pln | |
| Ambeed | 500g | 2762.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A589092 |
4-chloro-3-(trifluoromethyl)phenol (CAS 6294-93-5) is a chemical compound with the molecular formula C7H4ClF3O and a molecular weight of 196.55 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)phenol. InChIKey: ZLFPIEUWXNRPNM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O |
|---|---|
| Molecular weight | 196.55 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)phenol |
| InChIKey | ZLFPIEUWXNRPNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)