CAS 252004-68-5 appears in our catalog under these names: 4-Chloro-2,3,6-trifluorobenzyl alcohol, 95%, (4-Chloro-2,3,6-trifluorophenyl)methanol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(4-chloro-2,3,6-trifluorophenyl)methanol (CAS 252004-68-5) is a chemical compound with the molecular formula C7H4ClF3O and a molecular weight of 196.55 g/mol. IUPAC name: (4-chloro-2,3,6-trifluorophenyl)methanol. InChIKey: ZHKDUZIFNFQCPE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O |
|---|---|
| Molecular weight | 196.55 g/mol |
| IUPAC name | (4-chloro-2,3,6-trifluorophenyl)methanol |
| InChIKey | ZHKDUZIFNFQCPE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)F)CO)F |
Computed by PubChem (NCBI)