CAS 6294-93-5 appears in our catalog under these names: 2-Chloro-5-hydroxybenzotrifluoride, 98%, 2-Chloro-5-hydroxybenzotrifluoride 97%, 2-Chloro-5-hydroxybenzotrifluoride, >98.0%(GC), 4–Chloro–3–(trifluoromethyl)phenol. Offered by: Combi-blocks, Ambeed, Fluorochem, TCI, GLPBio. Available pack sizes: 500g, 100g, 25g, 5g, 1g, 10g.
4-chloro-3-(trifluoromethyl)phenol (CAS 6294-93-5) is a chemical compound with the molecular formula C7H4ClF3O and a molecular weight of 196.55 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)phenol. InChIKey: ZLFPIEUWXNRPNM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O |
|---|---|
| Molecular weight | 196.55 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)phenol |
| InChIKey | ZLFPIEUWXNRPNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)