cas: 1003711-55-4 — see every product listed under this CAS number, including other names
2-Chloro-5-methoxy-3-nitropyridine, 98%, 98% (CAS 1003711-55-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112SL-100mg |
| cas | 1003711-55-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1346.00 Pln | |
| Chemat | 5g | 4566.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-5-methoxy-3-nitropyridine (CAS 1003711-55-4) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-chloro-5-methoxy-3-nitropyridine. InChIKey: AUHIVEPPZZIGNI-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-chloro-5-methoxy-3-nitropyridine |
| InChIKey | AUHIVEPPZZIGNI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(N=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)