cas: 60323-96-8 — see every product listed under this CAS number, including other names
2-Chloro-5-methyl-4-nitropyridine N-oxide, 97%, 97% (CAS 60323-96-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBNQ-100g |
| cas | 60323-96-8 |
| size | 100g |
| availability | 190g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 1936.40 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 539.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-5-methyl-4-nitro-1-oxidopyridin-1-ium (CAS 60323-96-8) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-chloro-5-methyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: DXJQKWNJVPTPSK-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-chloro-5-methyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | DXJQKWNJVPTPSK-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C=C1[N+](=O)[O-])Cl)[O-] |
Computed by PubChem (NCBI)