cas: 143007-15-2 — see every product listed under this CAS number, including other names
2-Chloro-6,7-difluoroquinoxaline, 98%, 98% (CAS 143007-15-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118Z70-100mg |
| cas | 143007-15-2 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1192.40 Pln | |
| Chemat | 5g | 2747.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6,7-difluoroquinoxaline (CAS 143007-15-2) is a chemical compound with the molecular formula C8H3ClF2N2 and a molecular weight of 200.57 g/mol. IUPAC name: 2-chloro-6,7-difluoroquinoxaline. InChIKey: BJQGARNEDBXHQC-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF2N2 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 2-chloro-6,7-difluoroquinoxaline |
| InChIKey | BJQGARNEDBXHQC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)N=C(C=N2)Cl |
Computed by PubChem (NCBI)