2-Chloro-6,7-difluoroquinoxaline, 98%
cas: 143007-15-2 — see every product listed under this CAS number, including other names
2-Chloro-6,7-difluoroquinoxaline, 98% (CAS 143007-15-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F618933-100MG |
| cas | 143007-15-2 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 1g | 1549.47 Pln | |
| Fluorochem | 5g | 3767.44 Pln | |
| Fluorochem | 10g | 7328.69 Pln | |
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| Chemat | 50mg | 174.80 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1192.40 Pln | |
| Chemat | 5g | 2747.60 Pln | |
| Chemat | 10g | 5430.80 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 653.13 Pln | |
| BLDpharm | 1g | 1608.35 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-chloro-6,7-difluoroquinoxaline (CAS 143007-15-2) is a chemical compound with the molecular formula C8H3ClF2N2 and a molecular weight of 200.57 g/mol. IUPAC name: 2-chloro-6,7-difluoroquinoxaline. InChIKey: BJQGARNEDBXHQC-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF2N2 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 2-chloro-6,7-difluoroquinoxaline |
| InChIKey | BJQGARNEDBXHQC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)N=C(C=N2)Cl |
Computed by PubChem (NCBI)