cas: 652148-92-0 — see every product listed under this CAS number, including other names
2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 98% (CAS 652148-92-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A296735-250mg |
| cas | 652148-92-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 681.88 Pln | |
| Ambeed | 10g | 1115.75 Pln | |
| Ambeed | 25g | 2228.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A296735 |
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 652148-92-0) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: CROJXBLQCOIOBI-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | CROJXBLQCOIOBI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)