cas: 652148-92-0 — see every product listed under this CAS number, including other names
2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%, 95% (CAS 652148-92-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E08P-100mg |
| cas | 652148-92-0 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 702.80 Pln | |
| Chemat | 25g | 1542.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 652148-92-0) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: CROJXBLQCOIOBI-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | CROJXBLQCOIOBI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)