cas: 1196155-38-0 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethyl)isonicotinonitrile, 95%, 95% (CAS 1196155-38-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PBU-100g |
| cas | 1196155-38-0 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 8258.00 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 794.00 Pln | |
| Chemat | 10g | 1384.40 Pln | |
| Chemat | 25g | 2622.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-(trifluoromethyl)pyridine-4-carbonitrile (CAS 1196155-38-0) is a chemical compound with the molecular formula C7H2ClF3N2 and a molecular weight of 206.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-4-carbonitrile. InChIKey: DKJFUZIDAHUIJV-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2 |
|---|---|
| Molecular weight | 206.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-4-carbonitrile |
| InChIKey | DKJFUZIDAHUIJV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Cl)C#N |
Computed by PubChem (NCBI)