cas: 1196155-38-0 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethyl)isonicotinonitrile, 95% (CAS 1196155-38-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319725-250MG |
| cas | 1196155-38-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 914.28 Pln | |
| Fluorochem | 10g | 1606.74 Pln | |
| Fluorochem | 25g | 3064.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-(trifluoromethyl)pyridine-4-carbonitrile (CAS 1196155-38-0) is a chemical compound with the molecular formula C7H2ClF3N2 and a molecular weight of 206.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-4-carbonitrile. InChIKey: DKJFUZIDAHUIJV-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2 |
|---|---|
| Molecular weight | 206.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-4-carbonitrile |
| InChIKey | DKJFUZIDAHUIJV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Cl)C#N |
Computed by PubChem (NCBI)