cas: 386704-06-9 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethyl)nicotinonitrile 98% (CAS 386704-06-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A385717-1g |
| cas | 386704-06-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 1065.69 Pln | |
| Ambeed | 100g | 4047.19 Pln | |
| Ambeed | 500g | 15973.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A385717 |
2-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile (CAS 386704-06-9) is a chemical compound with the molecular formula C7H2ClF3N2 and a molecular weight of 206.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: CDSFASYGONAHHN-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2 |
|---|---|
| Molecular weight | 206.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | CDSFASYGONAHHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C#N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)