cas: 386704-06-9 — see every product listed under this CAS number, including other names
2-Chloro-6-trifluoromethylnicotinonitrile (CAS 386704-06-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009103-250MG |
| cas | 386704-06-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 10g | 794.53 Pln | |
| Fluorochem | 25g | 1799.38 Pln |
| delivery time | 2-3 weeks |
|---|
2-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile (CAS 386704-06-9) is a chemical compound with the molecular formula C7H2ClF3N2 and a molecular weight of 206.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: CDSFASYGONAHHN-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2 |
|---|---|
| Molecular weight | 206.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | CDSFASYGONAHHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C#N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)