cas: 106877-36-5 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethyl)phenol, 95% (CAS 106877-36-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231137-250MG |
| cas | 106877-36-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1466.17 Pln | |
| Fluorochem | 10g | 2372.10 Pln | |
| Fluorochem | 25g | 4688.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-(trifluoromethyl)phenol (CAS 106877-36-5) is a chemical compound with the molecular formula C7H4ClF3O and a molecular weight of 196.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)phenol. InChIKey: GIBYEQRMTYSGII-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O |
|---|---|
| Molecular weight | 196.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)phenol |
| InChIKey | GIBYEQRMTYSGII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)O)C(F)(F)F |
Computed by PubChem (NCBI)