cas: 2121512-89-6 — see every product listed under this CAS number, including other names
2-Chloro-6-fluoro-3-hydroxyphenylboronic acid pinacol ester, 97%, 97% (CAS 2121512-89-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K734-250mg |
| cas | 2121512-89-6 |
| size | 250mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2121512-89-6) is a chemical compound with the molecular formula C12H15BClFO3 and a molecular weight of 272.51 g/mol. IUPAC name: 2-chloro-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: UHXVCXSLQMMDND-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO3 |
|---|---|
| Molecular weight | 272.51 g/mol |
| IUPAC name | 2-chloro-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | UHXVCXSLQMMDND-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2Cl)O)F |
Computed by PubChem (NCBI)