CAS 2121512-89-6 appears in our catalog under these names: 2-Chloro-6-fluoro-3-hydroxyphenylboronic acid pinacol ester, 95%, 2-Chloro-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 97%, 2-Chloro-6-fluoro-3-hydroxyphenylboronic acid pinacol ester, 97%, 97%, 2-Chloro-6-fluoro-3-hydroxyphenylboronic acid pinacol ester, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100g, 25g, 1g, 250mg.
2-chloro-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2121512-89-6) is a chemical compound with the molecular formula C12H15BClFO3 and a molecular weight of 272.51 g/mol. IUPAC name: 2-chloro-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: UHXVCXSLQMMDND-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO3 |
|---|---|
| Molecular weight | 272.51 g/mol |
| IUPAC name | 2-chloro-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | UHXVCXSLQMMDND-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2Cl)O)F |
Computed by PubChem (NCBI)