CAS 2121513-66-2 appears in our catalog under these names: 2-Chloro-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%, 5-Chloro-2-fluoro-4-hydroxyphenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
2-chloro-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2121513-66-2) is a chemical compound with the molecular formula C12H15BClFO3 and a molecular weight of 272.51 g/mol. IUPAC name: 2-chloro-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: DKEUOOKYCJIPOK-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO3 |
|---|---|
| Molecular weight | 272.51 g/mol |
| IUPAC name | 2-chloro-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | DKEUOOKYCJIPOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)O)Cl |
Computed by PubChem (NCBI)