cas: 65224-66-0 — see every product listed under this CAS number, including other names
2-Chloro-6-methyl-5-nitropyrimidin-4(1H)-one, 99%(HPLC),RG, 99%(HPLC),RG (CAS 65224-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EALS-100mg |
| cas | 65224-66-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1014.80 Pln | |
| Chemat | 5g | 4643.60 Pln |
| purity | 99%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one (CAS 65224-66-0) is a chemical compound with the molecular formula C5H4ClN3O3 and a molecular weight of 189.56 g/mol. IUPAC name: 2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one. InChIKey: GNXOLOBSWUZOEF-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O3 |
|---|---|
| Molecular weight | 189.56 g/mol |
| IUPAC name | 2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one |
| InChIKey | GNXOLOBSWUZOEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)