Products 1006962-20-4

CAS 1006962-20-4 appears in our catalog under these names: 1-Methyl-4-nitro-1H-pyrazole-5-carbonyl chloride, 95%, 1-Methyl-4-nitro-1H-pyrazole-5-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.

Structural formula: {0} (CAS {1})

1-methyl-4-nitropyrazole-5-carbonyl chloride (CAS 1006962-20-4) is a chemical compound with the molecular formula C5H4ClN3O3 and a molecular weight of 189.56 g/mol. IUPAC name: 1-methyl-4-nitropyrazole-5-carbonyl chloride. InChIKey: SRXRCBHJNPTZTL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClN3O3
Molecular weight189.56 g/mol
IUPAC name1-methyl-4-nitropyrazole-5-carbonyl chloride
InChIKeySRXRCBHJNPTZTL-UHFFFAOYSA-N
SMILESCN1C(=C(C=N1)[N+](=O)[O-])C(=O)Cl

Computed by PubChem (NCBI)