CAS 65224-66-0 appears in our catalog under these names: 2-Chloro-6-methyl-5-nitro-4(1h)-pyrimidinone, 97%, 2–Chloro–6–methyl–5–nitro–4(1h)–pyrimidinone, 2-Chloro-6-methyl-5-nitropyrimidin-4(1H)-one, 99%(HPLC),RG, 99%(HPLC),RG, 2-chloro-6-methyl-5-nitro-3,4-dihydropyrimidin-4-one, 99%(HPLC),RG. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one (CAS 65224-66-0) is a chemical compound with the molecular formula C5H4ClN3O3 and a molecular weight of 189.56 g/mol. IUPAC name: 2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one. InChIKey: GNXOLOBSWUZOEF-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O3 |
|---|---|
| Molecular weight | 189.56 g/mol |
| IUPAC name | 2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one |
| InChIKey | GNXOLOBSWUZOEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)