CAS 89894-44-0 appears in our catalog under these names: 2–Chloro–6–methylbenzoyl Chloride, 2-Chloro-6-methylbenzoyl chloride, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-chloro-6-methylbenzoyl chloride (CAS 89894-44-0) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 2-chloro-6-methylbenzoyl chloride. InChIKey: NPRWNQSMJBAKCL-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2-chloro-6-methylbenzoyl chloride |
| InChIKey | NPRWNQSMJBAKCL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)