cas: 26413-58-1 — see every product listed under this CAS number, including other names
2-Chloro-6-methylpyridine-4-carbonyl chloride (CAS 26413-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017201-100MG |
| cas | 26413-58-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 653.95 Pln | |
| Fluorochem | 5g | 1575.50 Pln |
| delivery time | 3-4 weeks |
|---|
2-chloro-6-methylpyridine-4-carbonyl chloride (CAS 26413-58-1) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2-chloro-6-methylpyridine-4-carbonyl chloride. InChIKey: YHKLLTUNTUJQSB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 2-chloro-6-methylpyridine-4-carbonyl chloride |
| InChIKey | YHKLLTUNTUJQSB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)